ChemNet > CAS > 1131-09-5 Benzo[b]thiophene-3-acetic acid
1131-09-5 Benzo[b]thiophene-3-acetic acid
| product Name |
Benzo[b]thiophene-3-acetic acid |
| Synonyms |
Thianaphthene-3-acetic acid; 1-benzothiophen-3-ylacetic acid |
| Molecular Formula |
C10H8O2S |
| Molecular Weight |
192.2343 |
| InChI |
InChI=1/C10H8O2S/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6H,5H2,(H,11,12) |
| CAS Registry Number |
1131-09-5 |
| EINECS |
214-461-2 |
| Molecular Structure |
![1131-09-5 Benzo[b]thiophene-3-acetic acid](https://images-a.chemnet.com/suppliers/chembase/cas3/cas1131-09-5.gif)
|
| Density |
1.368g/cm3 |
| Boiling point |
378.7°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
182.9°C |
| Vapour Pressur |
2.07E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
